C19H19NO2 — CID 142895022
acetylene;2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-7-methoxy-1H-quinolin-4-one (PubChem CID 142895022) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is acetylene;2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-7-methoxy-1H-quinolin-4-one.
| Compound Name | acetylene;2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-7-methoxy-1H-quinolin-4-one |
|---|---|
| PubChem CID | 142895022 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | acetylene;2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-7-methoxy-1H-quinolin-4-one |
| SMILES | C#C.C=C/C=C(\C=C/C)c1cc(=O)c2ccc(OC)cc2[nH]1 |
| InChI | InChI=1S/C17H17NO2.C2H2/c1-4-6-12(7-5-2)15-11-17(19)14-9-8-13(20-3)10-16(14)18-15;1-2/h4-11H,1H2,2-3H3,(H,18,19);1-2H/b7-5-,12-6+; |
| InChIKey | QDXATPVGSBFPAU-AOMYCQKGSA-N |
| XLogP | 3.93 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|