C11H9NO3 — CID 89262984
6-methoxy-1H-indole-2,3-dicarbaldehyde (PubChem CID 89262984) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is 6-methoxy-1H-indole-2,3-dicarbaldehyde.
| Compound Name | 6-methoxy-1H-indole-2,3-dicarbaldehyde |
|---|---|
| PubChem CID | 89262984 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 6-methoxy-1H-indole-2,3-dicarbaldehyde |
| SMILES | COc1ccc2c(C=O)c(C=O)[nH]c2c1 |
| InChI | InChI=1S/C11H9NO3/c1-15-7-2-3-8-9(5-13)11(6-14)12-10(8)4-7/h2-6,12H,1H3 |
| InChIKey | NXHAOLFZIMWIRZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|