C16H11NO3 — CID 11149760
8-methoxy-10H-furo[3,2-a]carbazole-4-carbaldehyde (PubChem CID 11149760) has the molecular formula C16H11NO3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 8-methoxy-10H-furo[3,2-a]carbazole-4-carbaldehyde.
| Compound Name | 8-methoxy-10H-furo[3,2-a]carbazole-4-carbaldehyde |
|---|---|
| PubChem CID | 11149760 |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 8-methoxy-10H-furo[3,2-a]carbazole-4-carbaldehyde |
| SMILES | COc1ccc2c(c1)[nH]c1c3ccoc3c(C=O)cc21 |
| InChI | InChI=1S/C16H11NO3/c1-19-10-2-3-11-13-6-9(8-18)16-12(4-5-20-16)15(13)17-14(11)7-10/h2-8,17H,1H3 |
| InChIKey | ILLXCWVBHYUIBM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|