C11H9N3O2 — CID 135764700
7-methoxy-3,5-dihydropyridazino[4,5-b]indol-4-one (PubChem CID 135764700) has the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. Its IUPAC name is 7-methoxy-3,5-dihydropyridazino[4,5-b]indol-4-one.
| Compound Name | 7-methoxy-3,5-dihydropyridazino[4,5-b]indol-4-one |
|---|---|
| PubChem CID | 135764700 |
| Molecular Formula | C11H9N3O2 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 7-methoxy-3,5-dihydropyridazino[4,5-b]indol-4-one |
| SMILES | COc1ccc2c(c1)[nH]c1c(=O)[nH]ncc12 |
| InChI | InChI=1S/C11H9N3O2/c1-16-6-2-3-7-8-5-12-14-11(15)10(8)13-9(7)4-6/h2-5,13H,1H3,(H,14,15) |
| InChIKey | FZXGORBQPXWVPI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |