C18H16N2O — CID 158854687
9-methoxy-2,3-dimethyl-11H-indolo[3,2-c]quinoline (PubChem CID 158854687) has the molecular formula C18H16N2O and a molecular weight of 276.34 g/mol. Its IUPAC name is 9-methoxy-2,3-dimethyl-11H-indolo[3,2-c]quinoline.
| Compound Name | 9-methoxy-2,3-dimethyl-11H-indolo[3,2-c]quinoline |
|---|---|
| PubChem CID | 158854687 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 9-methoxy-2,3-dimethyl-11H-indolo[3,2-c]quinoline |
| SMILES | COc1ccc2c(c1)[nH]c1c3cc(C)c(C)cc3ncc21 |
| InChI | InChI=1S/C18H16N2O/c1-10-6-14-16(7-11(10)2)19-9-15-13-5-4-12(21-3)8-17(13)20-18(14)15/h4-9,20H,1-3H3 |
| InChIKey | TZKJAPBXAMHURE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |