C14H13N3O3 — CID 141175145
methyl N-(7-methoxy-9H-pyrido[3,4-b]indol-1-yl)carbamate (PubChem CID 141175145) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is methyl N-(7-methoxy-9H-pyrido[3,4-b]indol-1-yl)carbamate.
| Compound Name | methyl N-(7-methoxy-9H-pyrido[3,4-b]indol-1-yl)carbamate |
|---|---|
| PubChem CID | 141175145 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | methyl N-(7-methoxy-9H-pyrido[3,4-b]indol-1-yl)carbamate |
| SMILES | COC(=O)Nc1nccc2c1[nH]c1cc(OC)ccc12 |
| InChI | InChI=1S/C14H13N3O3/c1-19-8-3-4-9-10-5-6-15-13(17-14(18)20-2)12(10)16-11(9)7-8/h3-7,16H,1-2H3,(H,15,17,18) |
| InChIKey | KQHKYXWWMIOZSU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |