About 1H-indole;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole
1H-indole;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole (PubChem CID 175384815) has the molecular formula C21H19N3O
and a molecular weight of 329.40 g/mol. Its IUPAC name is 1H-indole;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 1H-indole;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole |
| PubChem CID | 175384815 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 1H-indole;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole |
| SMILES | COc1ccc2c(c1)[nH]c1c(C)nccc12.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C13H12N2O.C8H7N/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13;1-2-4-8-7(3-1)5-6-9-8/h3-7,15H,1-2H3;1-6,9H |
| InChIKey | XMORZZMCUDODKE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 53.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-indole;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole?
The IUPAC name of 1H-indole;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole (CID 175384815) is 1H-indole;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole.
What is the SMILES notation for 1H-indole;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole?
The canonical SMILES for 1H-indole;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole is COc1ccc2c(c1)[nH]c1c(C)nccc12.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole?
The InChIKey is XMORZZMCUDODKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O.C8H7N/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13;1-2-4-8-7(3-1)5-6-9-8/h3-7,15H,1-2H3;1-6,9H.
What are the key properties of 1H-indole;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole?
1H-indole;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole has a molecular weight of 329.40 g/mol, XLogP of 5.20, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole is sourced from PubChem (CID 175384815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).