C25H21N4O+ — CID 170384278
1-methyl-7-[(1-methyl-9H-pyrido[3,4-b]indol-2-ium-2-yl)methoxy]-9H-pyrido[3,4-b]indole (PubChem CID 170384278) has the molecular formula C25H21N4O+ and a molecular weight of 393.47 g/mol. Its IUPAC name is 1-methyl-7-[(1-methyl-9H-pyrido[3,4-b]indol-2-ium-2-yl)methoxy]-9H-pyrido[3,4-b]indole.
| Compound Name | 1-methyl-7-[(1-methyl-9H-pyrido[3,4-b]indol-2-ium-2-yl)methoxy]-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 170384278 |
| Molecular Formula | C25H21N4O+ |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 1-methyl-7-[(1-methyl-9H-pyrido[3,4-b]indol-2-ium-2-yl)methoxy]-9H-pyrido[3,4-b]indole |
| SMILES | Cc1nccc2c1[nH]c1cc(OC[n+]3ccc4c([nH]c5ccccc54)c3C)ccc12 |
| InChI | InChI=1S/C25H20N4O/c1-15-24-20(9-11-26-15)19-8-7-17(13-23(19)28-24)30-14-29-12-10-21-18-5-3-4-6-22(18)27-25(21)16(29)2/h3-13H,14H2,1-2H3,(H,26,28)/p+1 |
| InChIKey | VXNPLIZLXDBWKF-UHFFFAOYSA-O |
| XLogP | 5.29 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|