C13H13N2+ — CID 11199472
1,2-dimethyl-9H-pyrido[3,4-b]indol-2-ium (PubChem CID 11199472) has the molecular formula C13H13N2+ and a molecular weight of 197.26 g/mol. Its IUPAC name is 1,2-dimethyl-9H-pyrido[3,4-b]indol-2-ium.
| Compound Name | 1,2-dimethyl-9H-pyrido[3,4-b]indol-2-ium |
|---|---|
| PubChem CID | 11199472 |
| Molecular Formula | C13H13N2+ |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 1,2-dimethyl-9H-pyrido[3,4-b]indol-2-ium |
| SMILES | Cc1c2[nH]c3ccccc3c2cc[n+]1C |
| InChI | InChI=1S/C13H12N2/c1-9-13-11(7-8-15(9)2)10-5-3-4-6-12(10)14-13/h3-8H,1-2H3/p+1 |
| InChIKey | WURQJRLLMSPUST-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|