C24H29N3+2 — CID 3048095
benzyl-dimethyl-[3-(1-methyl-9H-pyrido[3,4-b]indol-2-ium-2-yl)propyl]azanium (PubChem CID 3048095) has the molecular formula C24H29N3+2 and a molecular weight of 359.52 g/mol. Its IUPAC name is benzyl-dimethyl-[3-(1-methyl-9H-pyrido[3,4-b]indol-2-ium-2-yl)propyl]azanium.
| Compound Name | benzyl-dimethyl-[3-(1-methyl-9H-pyrido[3,4-b]indol-2-ium-2-yl)propyl]azanium |
|---|---|
| PubChem CID | 3048095 |
| Molecular Formula | C24H29N3+2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | benzyl-dimethyl-[3-(1-methyl-9H-pyrido[3,4-b]indol-2-ium-2-yl)propyl]azanium |
| SMILES | Cc1c2[nH]c3ccccc3c2cc[n+]1CCC[N+](C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C24H28N3/c1-19-24-22(21-12-7-8-13-23(21)25-24)14-16-26(19)15-9-17-27(2,3)18-20-10-5-4-6-11-20/h4-8,10-14,16H,9,15,17-18H2,1-3H3/q+1/p+1 |
| InChIKey | CFWGZFYAGIBFNI-UHFFFAOYSA-O |
| XLogP | 4.58 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|