C20H16BrF3N2 — CID 122178005
1-methyl-2-[[4-(trifluoromethyl)phenyl]methyl]-9H-pyrido[3,4-b]indol-2-ium bromide (PubChem CID 122178005) has the molecular formula C20H16BrF3N2 and a molecular weight of 421.26 g/mol. Its IUPAC name is 1-methyl-2-[[4-(trifluoromethyl)phenyl]methyl]-9H-pyrido[3,4-b]indol-2-ium bromide.
| Compound Name | 1-methyl-2-[[4-(trifluoromethyl)phenyl]methyl]-9H-pyrido[3,4-b]indol-2-ium bromide |
|---|---|
| PubChem CID | 122178005 |
| Molecular Formula | C20H16BrF3N2 |
| Molecular Weight | 421.26 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 1-methyl-2-[[4-(trifluoromethyl)phenyl]methyl]-9H-pyrido[3,4-b]indol-2-ium bromide |
| SMILES | Cc1c2[nH]c3ccccc3c2cc[n+]1Cc1ccc(C(F)(F)F)cc1.[Br-] |
| InChI | InChI=1S/C20H15F3N2.BrH/c1-13-19-17(16-4-2-3-5-18(16)24-19)10-11-25(13)12-14-6-8-15(9-7-14)20(21,22)23;/h2-11H,12H2,1H3;1H |
| InChIKey | VINGXNZQFBFRRE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|