C19H16BrClN2 — CID 122178003
2-[(4-chlorophenyl)methyl]-1-methyl-9H-pyrido[3,4-b]indol-2-ium bromide (PubChem CID 122178003) has the molecular formula C19H16BrClN2 and a molecular weight of 387.71 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-1-methyl-9H-pyrido[3,4-b]indol-2-ium bromide.
| Compound Name | 2-[(4-chlorophenyl)methyl]-1-methyl-9H-pyrido[3,4-b]indol-2-ium bromide |
|---|---|
| PubChem CID | 122178003 |
| Molecular Formula | C19H16BrClN2 |
| Molecular Weight | 387.71 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-1-methyl-9H-pyrido[3,4-b]indol-2-ium bromide |
| SMILES | Cc1c2[nH]c3ccccc3c2cc[n+]1Cc1ccc(Cl)cc1.[Br-] |
| InChI | InChI=1S/C19H15ClN2.BrH/c1-13-19-17(16-4-2-3-5-18(16)21-19)10-11-22(13)12-14-6-8-15(20)9-7-14;/h2-11H,12H2,1H3;1H |
| InChIKey | HCSXDSISIFICIY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.71 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|