C25H17ClN3+ — CID 170637609
4-(4-chlorophenyl)-3-phenyl-4,16-diaza-6-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,7,10,12,14-heptaene (PubChem CID 170637609) has the molecular formula C25H17ClN3+ and a molecular weight of 394.89 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3-phenyl-4,16-diaza-6-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,7,10,12,14-heptaene.
| Compound Name | 4-(4-chlorophenyl)-3-phenyl-4,16-diaza-6-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,7,10,12,14-heptaene |
|---|---|
| PubChem CID | 170637609 |
| Molecular Formula | C25H17ClN3+ |
| Molecular Weight | 394.89 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 4-(4-chlorophenyl)-3-phenyl-4,16-diaza-6-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,7,10,12,14-heptaene |
| SMILES | Clc1ccc(-n2c[n+]3ccc4c5ccccc5[nH]c4c3c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H17ClN3/c26-18-10-12-19(13-11-18)29-16-28-15-14-21-20-8-4-5-9-22(20)27-23(21)25(28)24(29)17-6-2-1-3-7-17/h1-16,27H/q+1 |
| InChIKey | ZWMUBLPQFMLRRS-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 24.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.89 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|