C25H17Cl2N3 — CID 170637480
4-(3-chlorophenyl)-3-phenyl-4,16-diaza-6-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,7,10,12,14-heptaene chloride (PubChem CID 170637480) has the molecular formula C25H17Cl2N3 and a molecular weight of 430.34 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-3-phenyl-4,16-diaza-6-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,7,10,12,14-heptaene chloride.
| Compound Name | 4-(3-chlorophenyl)-3-phenyl-4,16-diaza-6-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,7,10,12,14-heptaene chloride |
|---|---|
| PubChem CID | 170637480 |
| Molecular Formula | C25H17Cl2N3 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 4-(3-chlorophenyl)-3-phenyl-4,16-diaza-6-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,7,10,12,14-heptaene chloride |
| SMILES | Clc1cccc(-n2c[n+]3ccc4c5ccccc5[nH]c4c3c2-c2ccccc2)c1.[Cl-] |
| InChI | InChI=1S/C25H17ClN3.ClH/c26-18-9-6-10-19(15-18)29-16-28-14-13-21-20-11-4-5-12-22(20)27-23(21)25(28)24(29)17-7-2-1-3-8-17;/h1-16,27H;1H/q+1;/p-1 |
| InChIKey | WZPHHNSHNCUSBP-UHFFFAOYSA-M |
| XLogP | 3.17 |
| TPSA | 24.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|