About bis(9H-carbazole);1-chloro-3-phenylbenzene;1,3,5-triazine
bis(9H-carbazole);1-chloro-3-phenylbenzene;1,3,5-triazine (PubChem CID 160708594) has the molecular formula C39H30ClN5
and a molecular weight of 604.16 g/mol. Its IUPAC name is bis(9H-carbazole);1-chloro-3-phenylbenzene;1,3,5-triazine.
Molecular Properties
| Compound Name | bis(9H-carbazole);1-chloro-3-phenylbenzene;1,3,5-triazine |
| PubChem CID | 160708594 |
| Molecular Formula | C39H30ClN5 |
| Molecular Weight | 604.16 g/mol |
| Exact Mass | 603.22 |
| IUPAC Name | bis(9H-carbazole);1-chloro-3-phenylbenzene;1,3,5-triazine |
| SMILES | Clc1cccc(-c2ccccc2)c1.c1ccc2c(c1)[nH]c1ccccc12.c1ccc2c(c1)[nH]c1ccccc12.c1ncncn1 |
| InChI | InChI=1S/C12H9Cl.2C12H9N.C3H3N3/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10;2*1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-4-2-6-3-5-1/h1-9H;2*1-8,13H;1-3H |
| InChIKey | RRNZXUIBVQOUPV-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 604.16 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(9H-carbazole);1-chloro-3-phenylbenzene;1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(9H-carbazole);1-chloro-3-phenylbenzene;1,3,5-triazine?
The IUPAC name of bis(9H-carbazole);1-chloro-3-phenylbenzene;1,3,5-triazine (CID 160708594) is bis(9H-carbazole);1-chloro-3-phenylbenzene;1,3,5-triazine.
What is the SMILES notation for bis(9H-carbazole);1-chloro-3-phenylbenzene;1,3,5-triazine?
The canonical SMILES for bis(9H-carbazole);1-chloro-3-phenylbenzene;1,3,5-triazine is Clc1cccc(-c2ccccc2)c1.c1ccc2c(c1)[nH]c1ccccc12.c1ccc2c(c1)[nH]c1ccccc12.c1ncncn1.
What is the InChIKey of bis(9H-carbazole);1-chloro-3-phenylbenzene;1,3,5-triazine?
The InChIKey is RRNZXUIBVQOUPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Cl.2C12H9N.C3H3N3/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10;2*1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-4-2-6-3-5-1/h1-9H;2*1-8,13H;1-3H.
What are the key properties of bis(9H-carbazole);1-chloro-3-phenylbenzene;1,3,5-triazine?
bis(9H-carbazole);1-chloro-3-phenylbenzene;1,3,5-triazine has a molecular weight of 604.16 g/mol, XLogP of 10.52, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(9H-carbazole);1-chloro-3-phenylbenzene;1,3,5-triazine is sourced from PubChem (CID 160708594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).