About 9H-carbazole;2-phenylpyrimidine
9H-carbazole;2-phenylpyrimidine (PubChem CID 135341743) has the molecular formula C22H17N3
and a molecular weight of 323.40 g/mol. Its IUPAC name is 9H-carbazole;2-phenylpyrimidine.
Molecular Properties
| Compound Name | 9H-carbazole;2-phenylpyrimidine |
| PubChem CID | 135341743 |
| Molecular Formula | C22H17N3 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 9H-carbazole;2-phenylpyrimidine |
| SMILES | c1ccc(-c2ncccn2)cc1.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C12H9N.C10H8N2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-5-9(6-3-1)10-11-7-4-8-12-10/h1-8,13H;1-8H |
| InChIKey | XEOLTFHRBSPASD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-carbazole;2-phenylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole;2-phenylpyrimidine?
The IUPAC name of 9H-carbazole;2-phenylpyrimidine (CID 135341743) is 9H-carbazole;2-phenylpyrimidine.
What is the SMILES notation for 9H-carbazole;2-phenylpyrimidine?
The canonical SMILES for 9H-carbazole;2-phenylpyrimidine is c1ccc(-c2ncccn2)cc1.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of 9H-carbazole;2-phenylpyrimidine?
The InChIKey is XEOLTFHRBSPASD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N.C10H8N2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-5-9(6-3-1)10-11-7-4-8-12-10/h1-8,13H;1-8H.
What are the key properties of 9H-carbazole;2-phenylpyrimidine?
9H-carbazole;2-phenylpyrimidine has a molecular weight of 323.40 g/mol, XLogP of 5.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole;2-phenylpyrimidine is sourced from PubChem (CID 135341743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).