C15H12N2 — CID 151112967
8,17-diazatricyclo[8.7.0.011,16]heptadeca-1(10),2,4,6,8,11,13,15-octaene (PubChem CID 151112967) has the molecular formula C15H12N2 and a molecular weight of 220.28 g/mol. Its IUPAC name is 8,17-diazatricyclo[8.7.0.011,16]heptadeca-1(10),2,4,6,8,11,13,15-octaene.
| Compound Name | 8,17-diazatricyclo[8.7.0.011,16]heptadeca-1(10),2,4,6,8,11,13,15-octaene |
|---|---|
| PubChem CID | 151112967 |
| Molecular Formula | C15H12N2 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 8,17-diazatricyclo[8.7.0.011,16]heptadeca-1(10),2,4,6,8,11,13,15-octaene |
| SMILES | c1cccc2[nH]c3ccccc3c2cncc1 |
| InChI | InChI=1S/C15H12N2/c1-2-6-10-16-11-13-12-7-4-5-9-14(12)17-15(13)8-3-1/h1-11,17H/b2-1-,3-1+,6-2-,8-3+,10-6-,13-11-,15-8+,16-10+,16-11+ |
| InChIKey | FAXAUQCMSBOIFV-WCZFNEDZSA-N |
| XLogP | 3.84 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |