About 9H-carbazole;N,N-diphenylaniline;pyridine
9H-carbazole;N,N-diphenylaniline;pyridine (PubChem CID 175394994) has the molecular formula C35H29N3
and a molecular weight of 491.64 g/mol. Its IUPAC name is 9H-carbazole;N,N-diphenylaniline;pyridine.
Molecular Properties
| Compound Name | 9H-carbazole;N,N-diphenylaniline;pyridine |
| PubChem CID | 175394994 |
| Molecular Formula | C35H29N3 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | 9H-carbazole;N,N-diphenylaniline;pyridine |
| SMILES | c1ccc(N(c2ccccc2)c2ccccc2)cc1.c1ccc2c(c1)[nH]c1ccccc12.c1ccncc1 |
| InChI | InChI=1S/C18H15N.C12H9N.C5H5N/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-4-6-5-3-1/h1-15H;1-8,13H;1-5H |
| InChIKey | GYVWCLXWCPHYII-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-carbazole;N,N-diphenylaniline;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole;N,N-diphenylaniline;pyridine?
The IUPAC name of 9H-carbazole;N,N-diphenylaniline;pyridine (CID 175394994) is 9H-carbazole;N,N-diphenylaniline;pyridine.
What is the SMILES notation for 9H-carbazole;N,N-diphenylaniline;pyridine?
The canonical SMILES for 9H-carbazole;N,N-diphenylaniline;pyridine is c1ccc(N(c2ccccc2)c2ccccc2)cc1.c1ccc2c(c1)[nH]c1ccccc12.c1ccncc1.
What is the InChIKey of 9H-carbazole;N,N-diphenylaniline;pyridine?
The InChIKey is GYVWCLXWCPHYII-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N.C12H9N.C5H5N/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-4-6-5-3-1/h1-15H;1-8,13H;1-5H.
What are the key properties of 9H-carbazole;N,N-diphenylaniline;pyridine?
9H-carbazole;N,N-diphenylaniline;pyridine has a molecular weight of 491.64 g/mol, XLogP of 9.56, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole;N,N-diphenylaniline;pyridine is sourced from PubChem (CID 175394994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).