About N,N-diphenylaniline;1H-pyrazole;pyridine
N,N-diphenylaniline;1H-pyrazole;pyridine (PubChem CID 174794888) has the molecular formula C26H24N4
and a molecular weight of 392.51 g/mol. Its IUPAC name is N,N-diphenylaniline;1H-pyrazole;pyridine.
Molecular Properties
| Compound Name | N,N-diphenylaniline;1H-pyrazole;pyridine |
| PubChem CID | 174794888 |
| Molecular Formula | C26H24N4 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | N,N-diphenylaniline;1H-pyrazole;pyridine |
| SMILES | c1ccc(N(c2ccccc2)c2ccccc2)cc1.c1ccncc1.c1cn[nH]c1 |
| InChI | InChI=1S/C18H15N.C5H5N.C3H4N2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-4-6-5-3-1;1-2-4-5-3-1/h1-15H;1-5H;1-3H,(H,4,5) |
| InChIKey | OWHGTSUXKPSPNJ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diphenylaniline;1H-pyrazole;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diphenylaniline;1H-pyrazole;pyridine?
The IUPAC name of N,N-diphenylaniline;1H-pyrazole;pyridine (CID 174794888) is N,N-diphenylaniline;1H-pyrazole;pyridine.
What is the SMILES notation for N,N-diphenylaniline;1H-pyrazole;pyridine?
The canonical SMILES for N,N-diphenylaniline;1H-pyrazole;pyridine is c1ccc(N(c2ccccc2)c2ccccc2)cc1.c1ccncc1.c1cn[nH]c1.
What is the InChIKey of N,N-diphenylaniline;1H-pyrazole;pyridine?
The InChIKey is OWHGTSUXKPSPNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N.C5H5N.C3H4N2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-4-6-5-3-1;1-2-4-5-3-1/h1-15H;1-5H;1-3H,(H,4,5).
What are the key properties of N,N-diphenylaniline;1H-pyrazole;pyridine?
N,N-diphenylaniline;1H-pyrazole;pyridine has a molecular weight of 392.51 g/mol, XLogP of 6.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diphenylaniline;1H-pyrazole;pyridine is sourced from PubChem (CID 174794888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).