C21H18N4 — CID 157284330
N,N-diphenylaniline;triazine (PubChem CID 157284330) has the molecular formula C21H18N4 and a molecular weight of 326.40 g/mol. Its IUPAC name is N,N-diphenylaniline;triazine.
| Compound Name | N,N-diphenylaniline;triazine |
|---|---|
| PubChem CID | 157284330 |
| Molecular Formula | C21H18N4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N,N-diphenylaniline;triazine |
| SMILES | c1ccc(N(c2ccccc2)c2ccccc2)cc1.c1cnnnc1 |
| InChI | InChI=1S/C18H15N.C3H3N3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-4-6-5-3-1/h1-15H;1-3H |
| InChIKey | BAAUANLCIHMZCK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |