C19H22N2 — CID 174725062
azane;N,N-diphenylaniline;methane (PubChem CID 174725062) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is azane;N,N-diphenylaniline;methane.
| Compound Name | azane;N,N-diphenylaniline;methane |
|---|---|
| PubChem CID | 174725062 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | azane;N,N-diphenylaniline;methane |
| SMILES | C.N.c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15N.CH4.H3N/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15H;1H4;1H3 |
| InChIKey | PQFLFZXHSQEZMK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 38.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |