About 1H-pyrazole;pyridine;thiophene
1H-pyrazole;pyridine;thiophene (PubChem CID 158592325) has the molecular formula C12H13N3S
and a molecular weight of 231.32 g/mol. Its IUPAC name is 1H-pyrazole;pyridine;thiophene.
Molecular Properties
| Compound Name | 1H-pyrazole;pyridine;thiophene |
| PubChem CID | 158592325 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 1H-pyrazole;pyridine;thiophene |
| SMILES | c1ccncc1.c1ccsc1.c1cn[nH]c1 |
| InChI | InChI=1S/C5H5N.C4H4S.C3H4N2/c1-2-4-6-5-3-1;2*1-2-4-5-3-1/h1-5H;1-4H;1-3H,(H,4,5) |
| InChIKey | HUPFCSWKHHXZGS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrazole;pyridine;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazole;pyridine;thiophene?
The IUPAC name of 1H-pyrazole;pyridine;thiophene (CID 158592325) is 1H-pyrazole;pyridine;thiophene.
What is the SMILES notation for 1H-pyrazole;pyridine;thiophene?
The canonical SMILES for 1H-pyrazole;pyridine;thiophene is c1ccncc1.c1ccsc1.c1cn[nH]c1.
What is the InChIKey of 1H-pyrazole;pyridine;thiophene?
The InChIKey is HUPFCSWKHHXZGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N.C4H4S.C3H4N2/c1-2-4-6-5-3-1;2*1-2-4-5-3-1/h1-5H;1-4H;1-3H,(H,4,5).
What are the key properties of 1H-pyrazole;pyridine;thiophene?
1H-pyrazole;pyridine;thiophene has a molecular weight of 231.32 g/mol, XLogP of 3.24, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazole;pyridine;thiophene is sourced from PubChem (CID 158592325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).