About 2-phenylacetonitrile;1H-pyrazole;thiophene
2-phenylacetonitrile;1H-pyrazole;thiophene (PubChem CID 174948928) has the molecular formula C15H15N3S
and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-phenylacetonitrile;1H-pyrazole;thiophene.
Molecular Properties
| Compound Name | 2-phenylacetonitrile;1H-pyrazole;thiophene |
| PubChem CID | 174948928 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 2-phenylacetonitrile;1H-pyrazole;thiophene |
| SMILES | N#CCc1ccccc1.c1ccsc1.c1cn[nH]c1 |
| InChI | InChI=1S/C8H7N.C4H4S.C3H4N2/c9-7-6-8-4-2-1-3-5-8;2*1-2-4-5-3-1/h1-5H,6H2;1-4H;1-3H,(H,4,5) |
| InChIKey | IFRMUOUYFJLJJF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenylacetonitrile;1H-pyrazole;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylacetonitrile;1H-pyrazole;thiophene?
The IUPAC name of 2-phenylacetonitrile;1H-pyrazole;thiophene (CID 174948928) is 2-phenylacetonitrile;1H-pyrazole;thiophene.
What is the SMILES notation for 2-phenylacetonitrile;1H-pyrazole;thiophene?
The canonical SMILES for 2-phenylacetonitrile;1H-pyrazole;thiophene is N#CCc1ccccc1.c1ccsc1.c1cn[nH]c1.
What is the InChIKey of 2-phenylacetonitrile;1H-pyrazole;thiophene?
The InChIKey is IFRMUOUYFJLJJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C4H4S.C3H4N2/c9-7-6-8-4-2-1-3-5-8;2*1-2-4-5-3-1/h1-5H,6H2;1-4H;1-3H,(H,4,5).
What are the key properties of 2-phenylacetonitrile;1H-pyrazole;thiophene?
2-phenylacetonitrile;1H-pyrazole;thiophene has a molecular weight of 269.37 g/mol, XLogP of 3.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylacetonitrile;1H-pyrazole;thiophene is sourced from PubChem (CID 174948928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).