About 9H-carbazole;phenoxybenzene
9H-carbazole;phenoxybenzene (PubChem CID 160983526) has the molecular formula C24H19NO
and a molecular weight of 337.42 g/mol. Its IUPAC name is 9H-carbazole;phenoxybenzene.
Molecular Properties
| Compound Name | 9H-carbazole;phenoxybenzene |
| PubChem CID | 160983526 |
| Molecular Formula | C24H19NO |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 9H-carbazole;phenoxybenzene |
| SMILES | c1ccc(Oc2ccccc2)cc1.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C12H9N.C12H10O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-8,13H;1-10H |
| InChIKey | SZUZDBGYIDTQEU-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9H-carbazole;phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole;phenoxybenzene?
The IUPAC name of 9H-carbazole;phenoxybenzene (CID 160983526) is 9H-carbazole;phenoxybenzene.
What is the SMILES notation for 9H-carbazole;phenoxybenzene?
The canonical SMILES for 9H-carbazole;phenoxybenzene is c1ccc(Oc2ccccc2)cc1.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of 9H-carbazole;phenoxybenzene?
The InChIKey is SZUZDBGYIDTQEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N.C12H10O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-8,13H;1-10H.
What are the key properties of 9H-carbazole;phenoxybenzene?
9H-carbazole;phenoxybenzene has a molecular weight of 337.42 g/mol, XLogP of 6.80, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole;phenoxybenzene is sourced from PubChem (CID 160983526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).