C26H19FN3O+ — CID 175985529
4-(4-fluorophenyl)-3-(4-methoxyphenyl)-4,16-diaza-6-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,7,10,12,14-heptaene (PubChem CID 175985529) has the molecular formula C26H19FN3O+ and a molecular weight of 408.46 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3-(4-methoxyphenyl)-4,16-diaza-6-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,7,10,12,14-heptaene.
| Compound Name | 4-(4-fluorophenyl)-3-(4-methoxyphenyl)-4,16-diaza-6-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,7,10,12,14-heptaene |
|---|---|
| PubChem CID | 175985529 |
| Molecular Formula | C26H19FN3O+ |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 4-(4-fluorophenyl)-3-(4-methoxyphenyl)-4,16-diaza-6-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,7,10,12,14-heptaene |
| SMILES | COc1ccc(-c2c3c4[nH]c5ccccc5c4cc[n+]3cn2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H19FN3O/c1-31-20-12-6-17(7-13-20)25-26-24-22(21-4-2-3-5-23(21)28-24)14-15-29(26)16-30(25)19-10-8-18(27)9-11-19/h2-16,28H,1H3/q+1 |
| InChIKey | NDWXSNBLQCNAMN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 34.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|