About 4-(4-methoxyphenyl)-1,2-diphenyl-9H-carbazole
4-(4-methoxyphenyl)-1,2-diphenyl-9H-carbazole (PubChem CID 102141749) has the molecular formula C31H23NO
and a molecular weight of 425.53 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1,2-diphenyl-9H-carbazole.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)-1,2-diphenyl-9H-carbazole |
| PubChem CID | 102141749 |
| Molecular Formula | C31H23NO |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 4-(4-methoxyphenyl)-1,2-diphenyl-9H-carbazole |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)c(-c3ccccc3)c3[nH]c4ccccc4c23)cc1 |
| InChI | InChI=1S/C31H23NO/c1-33-24-18-16-22(17-19-24)27-20-26(21-10-4-2-5-11-21)29(23-12-6-3-7-13-23)31-30(27)25-14-8-9-15-28(25)32-31/h2-20,32H,1H3 |
| InChIKey | MNEUPNDXBYPANU-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-methoxyphenyl)-1,2-diphenyl-9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)-1,2-diphenyl-9H-carbazole?
The IUPAC name of 4-(4-methoxyphenyl)-1,2-diphenyl-9H-carbazole (CID 102141749) is 4-(4-methoxyphenyl)-1,2-diphenyl-9H-carbazole.
What is the SMILES notation for 4-(4-methoxyphenyl)-1,2-diphenyl-9H-carbazole?
The canonical SMILES for 4-(4-methoxyphenyl)-1,2-diphenyl-9H-carbazole is COc1ccc(-c2cc(-c3ccccc3)c(-c3ccccc3)c3[nH]c4ccccc4c23)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)-1,2-diphenyl-9H-carbazole?
The InChIKey is MNEUPNDXBYPANU-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H23NO/c1-33-24-18-16-22(17-19-24)27-20-26(21-10-4-2-5-11-21)29(23-12-6-3-7-13-23)31-30(27)25-14-8-9-15-28(25)32-31/h2-20,32H,1H3.
What are the key properties of 4-(4-methoxyphenyl)-1,2-diphenyl-9H-carbazole?
4-(4-methoxyphenyl)-1,2-diphenyl-9H-carbazole has a molecular weight of 425.53 g/mol, XLogP of 8.33, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)-1,2-diphenyl-9H-carbazole is sourced from PubChem (CID 102141749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).