C19H12FN3O — CID 171985974
4-(4-fluorophenyl)-2-methoxy-5H-pyrido[3,2-b]indole-3-carbonitrile (PubChem CID 171985974) has the molecular formula C19H12FN3O and a molecular weight of 317.32 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-methoxy-5H-pyrido[3,2-b]indole-3-carbonitrile.
| Compound Name | 4-(4-fluorophenyl)-2-methoxy-5H-pyrido[3,2-b]indole-3-carbonitrile |
|---|---|
| PubChem CID | 171985974 |
| Molecular Formula | C19H12FN3O |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 4-(4-fluorophenyl)-2-methoxy-5H-pyrido[3,2-b]indole-3-carbonitrile |
| SMILES | COc1nc2c([nH]c3ccccc32)c(-c2ccc(F)cc2)c1C#N |
| InChI | InChI=1S/C19H12FN3O/c1-24-19-14(10-21)16(11-6-8-12(20)9-7-11)18-17(23-19)13-4-2-3-5-15(13)22-18/h2-9,22H,1H3 |
| InChIKey | MOTNSTOFFJKXEX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |