About 11,12-dihydroindolo[2,3-a]carbazole-5,6-dicarbonitrile
11,12-dihydroindolo[2,3-a]carbazole-5,6-dicarbonitrile (PubChem CID 131849022) has the molecular formula C20H10N4
and a molecular weight of 306.33 g/mol. Its IUPAC name is 11,12-dihydroindolo[2,3-a]carbazole-5,6-dicarbonitrile.
Molecular Properties
| Compound Name | 11,12-dihydroindolo[2,3-a]carbazole-5,6-dicarbonitrile |
| PubChem CID | 131849022 |
| Molecular Formula | C20H10N4 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 11,12-dihydroindolo[2,3-a]carbazole-5,6-dicarbonitrile |
| SMILES | N#Cc1c(C#N)c2c3ccccc3[nH]c2c2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C20H10N4/c21-9-13-14(10-22)18-12-6-2-4-8-16(12)24-20(18)19-17(13)11-5-1-3-7-15(11)23-19/h1-8,23-24H |
| InChIKey | NTOMXTZJQBBIGE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 11,12-dihydroindolo[2,3-a]carbazole-5,6-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11,12-dihydroindolo[2,3-a]carbazole-5,6-dicarbonitrile?
The IUPAC name of 11,12-dihydroindolo[2,3-a]carbazole-5,6-dicarbonitrile (CID 131849022) is 11,12-dihydroindolo[2,3-a]carbazole-5,6-dicarbonitrile.
What is the SMILES notation for 11,12-dihydroindolo[2,3-a]carbazole-5,6-dicarbonitrile?
The canonical SMILES for 11,12-dihydroindolo[2,3-a]carbazole-5,6-dicarbonitrile is N#Cc1c(C#N)c2c3ccccc3[nH]c2c2[nH]c3ccccc3c12.
What is the InChIKey of 11,12-dihydroindolo[2,3-a]carbazole-5,6-dicarbonitrile?
The InChIKey is NTOMXTZJQBBIGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10N4/c21-9-13-14(10-22)18-12-6-2-4-8-16(12)24-20(18)19-17(13)11-5-1-3-7-15(11)23-19/h1-8,23-24H.
What are the key properties of 11,12-dihydroindolo[2,3-a]carbazole-5,6-dicarbonitrile?
11,12-dihydroindolo[2,3-a]carbazole-5,6-dicarbonitrile has a molecular weight of 306.33 g/mol, XLogP of 4.70, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11,12-dihydroindolo[2,3-a]carbazole-5,6-dicarbonitrile is sourced from PubChem (CID 131849022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).