C15H12N2 — CID 101496372
3,4-dimethyl-9H-carbazole-1-carbonitrile (PubChem CID 101496372) has the molecular formula C15H12N2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 3,4-dimethyl-9H-carbazole-1-carbonitrile.
| Compound Name | 3,4-dimethyl-9H-carbazole-1-carbonitrile |
|---|---|
| PubChem CID | 101496372 |
| Molecular Formula | C15H12N2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 3,4-dimethyl-9H-carbazole-1-carbonitrile |
| SMILES | Cc1cc(C#N)c2[nH]c3ccccc3c2c1C |
| InChI | InChI=1S/C15H12N2/c1-9-7-11(8-16)15-14(10(9)2)12-5-3-4-6-13(12)17-15/h3-7,17H,1-2H3 |
| InChIKey | QZDJAVIFYSZUBY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |