C14H16N2 — CID 174760951
azane;1,2-dimethyl-9H-carbazole (PubChem CID 174760951) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is azane;1,2-dimethyl-9H-carbazole.
| Compound Name | azane;1,2-dimethyl-9H-carbazole |
|---|---|
| PubChem CID | 174760951 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | azane;1,2-dimethyl-9H-carbazole |
| SMILES | Cc1ccc2c([nH]c3ccccc32)c1C.N |
| InChI | InChI=1S/C14H13N.H3N/c1-9-7-8-12-11-5-3-4-6-13(11)15-14(12)10(9)2;/h3-8,15H,1-2H3;1H3 |
| InChIKey | QXNMWHIALOUZPY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 50.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |