About 3,4-dimethyl-11H-pyrano[2,3-a]carbazol-2-one
3,4-dimethyl-11H-pyrano[2,3-a]carbazol-2-one (PubChem CID 71519236) has the molecular formula C17H13NO2
and a molecular weight of 263.30 g/mol. Its IUPAC name is 3,4-dimethyl-11H-pyrano[2,3-a]carbazol-2-one.
Molecular Properties
| Compound Name | 3,4-dimethyl-11H-pyrano[2,3-a]carbazol-2-one |
| PubChem CID | 71519236 |
| Molecular Formula | C17H13NO2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 3,4-dimethyl-11H-pyrano[2,3-a]carbazol-2-one |
| SMILES | Cc1c(C)c2ccc3c4ccccc4[nH]c3c2oc1=O |
| InChI | InChI=1S/C17H13NO2/c1-9-10(2)17(19)20-16-11(9)7-8-13-12-5-3-4-6-14(12)18-15(13)16/h3-8,18H,1-2H3 |
| InChIKey | GDMGBWZUOZNWTL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-11H-pyrano[2,3-a]carbazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-11H-pyrano[2,3-a]carbazol-2-one?
The IUPAC name of 3,4-dimethyl-11H-pyrano[2,3-a]carbazol-2-one (CID 71519236) is 3,4-dimethyl-11H-pyrano[2,3-a]carbazol-2-one.
What is the SMILES notation for 3,4-dimethyl-11H-pyrano[2,3-a]carbazol-2-one?
The canonical SMILES for 3,4-dimethyl-11H-pyrano[2,3-a]carbazol-2-one is Cc1c(C)c2ccc3c4ccccc4[nH]c3c2oc1=O.
What is the InChIKey of 3,4-dimethyl-11H-pyrano[2,3-a]carbazol-2-one?
The InChIKey is GDMGBWZUOZNWTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO2/c1-9-10(2)17(19)20-16-11(9)7-8-13-12-5-3-4-6-14(12)18-15(13)16/h3-8,18H,1-2H3.
What are the key properties of 3,4-dimethyl-11H-pyrano[2,3-a]carbazol-2-one?
3,4-dimethyl-11H-pyrano[2,3-a]carbazol-2-one has a molecular weight of 263.30 g/mol, XLogP of 4.04, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-11H-pyrano[2,3-a]carbazol-2-one is sourced from PubChem (CID 71519236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).