C17H13NO2 — CID 71519236
3,4-dimethyl-11H-pyrano[2,3-a]carbazol-2-one (PubChem CID 71519236) has the molecular formula C17H13NO2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 3,4-dimethyl-11H-pyrano[2,3-a]carbazol-2-one.
| Compound Name | 3,4-dimethyl-11H-pyrano[2,3-a]carbazol-2-one |
|---|---|
| PubChem CID | 71519236 |
| Molecular Formula | C17H13NO2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 3,4-dimethyl-11H-pyrano[2,3-a]carbazol-2-one |
| SMILES | Cc1c(C)c2ccc3c4ccccc4[nH]c3c2oc1=O |
| InChI | InChI=1S/C17H13NO2/c1-9-10(2)17(19)20-16-11(9)7-8-13-12-5-3-4-6-14(12)18-15(13)16/h3-8,18H,1-2H3 |
| InChIKey | GDMGBWZUOZNWTL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|