C16H13NS — CID 144848398
2,3-dimethyl-10H-thieno[2,3-a]carbazole (PubChem CID 144848398) has the molecular formula C16H13NS and a molecular weight of 251.35 g/mol. Its IUPAC name is 2,3-dimethyl-10H-thieno[2,3-a]carbazole.
| Compound Name | 2,3-dimethyl-10H-thieno[2,3-a]carbazole |
|---|---|
| PubChem CID | 144848398 |
| Molecular Formula | C16H13NS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2,3-dimethyl-10H-thieno[2,3-a]carbazole |
| SMILES | Cc1sc2c(ccc3c4ccccc4[nH]c32)c1C |
| InChI | InChI=1S/C16H13NS/c1-9-10(2)18-16-11(9)7-8-13-12-5-3-4-6-14(12)17-15(13)16/h3-8,17H,1-2H3 |
| InChIKey | NKABVNWHSGCLNG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |