About iridium;1-methyl-2,9-dihydrocarbazol-2-ide
iridium;1-methyl-2,9-dihydrocarbazol-2-ide (PubChem CID 59806664) has the molecular formula C13H10IrN-
and a molecular weight of 372.45 g/mol. Its IUPAC name is iridium;1-methyl-2,9-dihydrocarbazol-2-ide.
Molecular Properties
| Compound Name | iridium;1-methyl-2,9-dihydrocarbazol-2-ide |
| PubChem CID | 59806664 |
| Molecular Formula | C13H10IrN- |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | iridium;1-methyl-2,9-dihydrocarbazol-2-ide |
| SMILES | Cc1[c-]ccc2c1[nH]c1ccccc12.[Ir] |
| InChI | InChI=1S/C13H10N.Ir/c1-9-5-4-7-11-10-6-2-3-8-12(10)14-13(9)11;/h2-4,6-8,14H,1H3;/q-1; |
| InChIKey | GBGVDFTUMIONOK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;1-methyl-2,9-dihydrocarbazol-2-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;1-methyl-2,9-dihydrocarbazol-2-ide?
The IUPAC name of iridium;1-methyl-2,9-dihydrocarbazol-2-ide (CID 59806664) is iridium;1-methyl-2,9-dihydrocarbazol-2-ide.
What is the SMILES notation for iridium;1-methyl-2,9-dihydrocarbazol-2-ide?
The canonical SMILES for iridium;1-methyl-2,9-dihydrocarbazol-2-ide is Cc1[c-]ccc2c1[nH]c1ccccc12.[Ir].
What is the InChIKey of iridium;1-methyl-2,9-dihydrocarbazol-2-ide?
The InChIKey is GBGVDFTUMIONOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N.Ir/c1-9-5-4-7-11-10-6-2-3-8-12(10)14-13(9)11;/h2-4,6-8,14H,1H3;/q-1;.
What are the key properties of iridium;1-methyl-2,9-dihydrocarbazol-2-ide?
iridium;1-methyl-2,9-dihydrocarbazol-2-ide has a molecular weight of 372.45 g/mol, XLogP of 3.43, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;1-methyl-2,9-dihydrocarbazol-2-ide is sourced from PubChem (CID 59806664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).