C17H15NS — CID 11448489
2,3,5-trimethyl-6H-thieno[3,2-c]carbazole (PubChem CID 11448489) has the molecular formula C17H15NS and a molecular weight of 265.38 g/mol. Its IUPAC name is 2,3,5-trimethyl-6H-thieno[3,2-c]carbazole.
| Compound Name | 2,3,5-trimethyl-6H-thieno[3,2-c]carbazole |
|---|---|
| PubChem CID | 11448489 |
| Molecular Formula | C17H15NS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2,3,5-trimethyl-6H-thieno[3,2-c]carbazole |
| SMILES | Cc1sc2c(cc(C)c3[nH]c4ccccc4c32)c1C |
| InChI | InChI=1S/C17H15NS/c1-9-8-13-10(2)11(3)19-17(13)15-12-6-4-5-7-14(12)18-16(9)15/h4-8,18H,1-3H3 |
| InChIKey | TUSRQQBSASOMNG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |