C13H13N3 — CID 68823015
2-methyl-9H-carbazole-1,4-diamine (PubChem CID 68823015) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 2-methyl-9H-carbazole-1,4-diamine.
| Compound Name | 2-methyl-9H-carbazole-1,4-diamine |
|---|---|
| PubChem CID | 68823015 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-methyl-9H-carbazole-1,4-diamine |
| SMILES | Cc1cc(N)c2c([nH]c3ccccc32)c1N |
| InChI | InChI=1S/C13H13N3/c1-7-6-9(14)11-8-4-2-3-5-10(8)16-13(11)12(7)15/h2-6,16H,14-15H2,1H3 |
| InChIKey | NJQSHISDJKXJBM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|