C15H17N3 — CID 68822595
1-N-ethyl-3-methyl-9H-carbazole-1,4-diamine (PubChem CID 68822595) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 1-N-ethyl-3-methyl-9H-carbazole-1,4-diamine.
| Compound Name | 1-N-ethyl-3-methyl-9H-carbazole-1,4-diamine |
|---|---|
| PubChem CID | 68822595 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 1-N-ethyl-3-methyl-9H-carbazole-1,4-diamine |
| SMILES | CCNc1cc(C)c(N)c2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C15H17N3/c1-3-17-12-8-9(2)14(16)13-10-6-4-5-7-11(10)18-15(12)13/h4-8,17-18H,3,16H2,1-2H3 |
| InChIKey | VRDJZSFVTXHDIZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|