C19H13NS — CID 167223191
21-thia-3-azapentacyclo[11.8.0.02,10.04,9.014,20]henicosa-1(13),2(10),4,6,8,11,14(20),15,18-nonaene (PubChem CID 167223191) has the molecular formula C19H13NS and a molecular weight of 287.39 g/mol. Its IUPAC name is 21-thia-3-azapentacyclo[11.8.0.02,10.04,9.014,20]henicosa-1(13),2(10),4,6,8,11,14(20),15,18-nonaene.
| Compound Name | 21-thia-3-azapentacyclo[11.8.0.02,10.04,9.014,20]henicosa-1(13),2(10),4,6,8,11,14(20),15,18-nonaene |
|---|---|
| PubChem CID | 167223191 |
| Molecular Formula | C19H13NS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 21-thia-3-azapentacyclo[11.8.0.02,10.04,9.014,20]henicosa-1(13),2(10),4,6,8,11,14(20),15,18-nonaene |
| SMILES | C1=Cc2sc3c(ccc4c5ccccc5[nH]c43)c2C=CC1 |
| InChI | InChI=1S/C19H13NS/c1-2-7-13-15-11-10-14-12-6-4-5-8-16(12)20-18(14)19(15)21-17(13)9-3-1/h2-11,20H,1H2 |
| InChIKey | DZMWAPLKJUHJCF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |