C14H8BrNO — CID 162350952
7-bromo-10H-[1]benzofuro[3,2-b]indole (PubChem CID 162350952) has the molecular formula C14H8BrNO and a molecular weight of 286.13 g/mol. Its IUPAC name is 7-bromo-10H-[1]benzofuro[3,2-b]indole.
| Compound Name | 7-bromo-10H-[1]benzofuro[3,2-b]indole |
|---|---|
| PubChem CID | 162350952 |
| Molecular Formula | C14H8BrNO |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 7-bromo-10H-[1]benzofuro[3,2-b]indole |
| SMILES | Brc1ccc2c(c1)oc1c3ccccc3[nH]c21 |
| InChI | InChI=1S/C14H8BrNO/c15-8-5-6-10-12(7-8)17-14-9-3-1-2-4-11(9)16-13(10)14/h1-7,16H |
| InChIKey | GJFWJDOFCBTREC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |