About 10H-[1]benzofuro[3,2-b]indole-8-carbonitrile
10H-[1]benzofuro[3,2-b]indole-8-carbonitrile (PubChem CID 118534063) has the molecular formula C15H8N2O
and a molecular weight of 232.24 g/mol. Its IUPAC name is 10H-[1]benzofuro[3,2-b]indole-8-carbonitrile.
Molecular Properties
| Compound Name | 10H-[1]benzofuro[3,2-b]indole-8-carbonitrile |
| PubChem CID | 118534063 |
| Molecular Formula | C15H8N2O |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 10H-[1]benzofuro[3,2-b]indole-8-carbonitrile |
| SMILES | N#Cc1ccc2oc3c4ccccc4[nH]c3c2c1 |
| InChI | InChI=1S/C15H8N2O/c16-8-9-5-6-13-11(7-9)14-15(18-13)10-3-1-2-4-12(10)17-14/h1-7,17H |
| InChIKey | HXOFFJNXSLSINV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10H-[1]benzofuro[3,2-b]indole-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-[1]benzofuro[3,2-b]indole-8-carbonitrile?
The IUPAC name of 10H-[1]benzofuro[3,2-b]indole-8-carbonitrile (CID 118534063) is 10H-[1]benzofuro[3,2-b]indole-8-carbonitrile.
What is the SMILES notation for 10H-[1]benzofuro[3,2-b]indole-8-carbonitrile?
The canonical SMILES for 10H-[1]benzofuro[3,2-b]indole-8-carbonitrile is N#Cc1ccc2oc3c4ccccc4[nH]c3c2c1.
What is the InChIKey of 10H-[1]benzofuro[3,2-b]indole-8-carbonitrile?
The InChIKey is HXOFFJNXSLSINV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8N2O/c16-8-9-5-6-13-11(7-9)14-15(18-13)10-3-1-2-4-12(10)17-14/h1-7,17H.
What are the key properties of 10H-[1]benzofuro[3,2-b]indole-8-carbonitrile?
10H-[1]benzofuro[3,2-b]indole-8-carbonitrile has a molecular weight of 232.24 g/mol, XLogP of 3.94, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-[1]benzofuro[3,2-b]indole-8-carbonitrile is sourced from PubChem (CID 118534063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).