C15H8N2O — CID 118534063
10H-[1]benzofuro[3,2-b]indole-8-carbonitrile (PubChem CID 118534063) has the molecular formula C15H8N2O and a molecular weight of 232.24 g/mol. Its IUPAC name is 10H-[1]benzofuro[3,2-b]indole-8-carbonitrile.
| Compound Name | 10H-[1]benzofuro[3,2-b]indole-8-carbonitrile |
|---|---|
| PubChem CID | 118534063 |
| Molecular Formula | C15H8N2O |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 10H-[1]benzofuro[3,2-b]indole-8-carbonitrile |
| SMILES | N#Cc1ccc2oc3c4ccccc4[nH]c3c2c1 |
| InChI | InChI=1S/C15H8N2O/c16-8-9-5-6-13-11(7-9)14-15(18-13)10-3-1-2-4-12(10)17-14/h1-7,17H |
| InChIKey | HXOFFJNXSLSINV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |