C21H12N2O — CID 118534036
4-(10H-[1]benzofuro[3,2-b]indol-7-yl)benzonitrile (PubChem CID 118534036) has the molecular formula C21H12N2O and a molecular weight of 308.34 g/mol. Its IUPAC name is 4-(10H-[1]benzofuro[3,2-b]indol-7-yl)benzonitrile.
| Compound Name | 4-(10H-[1]benzofuro[3,2-b]indol-7-yl)benzonitrile |
|---|---|
| PubChem CID | 118534036 |
| Molecular Formula | C21H12N2O |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 4-(10H-[1]benzofuro[3,2-b]indol-7-yl)benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c(c2)oc2c4ccccc4[nH]c32)cc1 |
| InChI | InChI=1S/C21H12N2O/c22-12-13-5-7-14(8-6-13)15-9-10-17-19(11-15)24-21-16-3-1-2-4-18(16)23-20(17)21/h1-11,23H |
| InChIKey | XFSZPFLUFRRHID-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 52.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |