C32H16N2O2 — CID 70854772
4-[16-(4-cyanophenyl)-10,20-dioxapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4(9),5,7,11,14(19),15,17-nonaen-6-yl]benzonitrile (PubChem CID 70854772) has the molecular formula C32H16N2O2 and a molecular weight of 460.49 g/mol. Its IUPAC name is 4-[16-(4-cyanophenyl)-10,20-dioxapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4(9),5,7,11,14(19),15,17-nonaen-6-yl]benzonitrile.
| Compound Name | 4-[16-(4-cyanophenyl)-10,20-dioxapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4(9),5,7,11,14(19),15,17-nonaen-6-yl]benzonitrile |
|---|---|
| PubChem CID | 70854772 |
| Molecular Formula | C32H16N2O2 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 4-[16-(4-cyanophenyl)-10,20-dioxapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4(9),5,7,11,14(19),15,17-nonaen-6-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3oc4cc5c(cc4c3c2)oc2ccc(-c3ccc(C#N)cc3)cc25)cc1 |
| InChI | InChI=1S/C32H16N2O2/c33-17-19-1-5-21(6-2-19)23-9-11-29-25(13-23)27-15-32-28(16-31(27)35-29)26-14-24(10-12-30(26)36-32)22-7-3-20(18-34)4-8-22/h1-16H |
| InChIKey | UCWPUYCNDNOBFW-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 73.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |