C34H20N4O — CID 139522713
4-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]benzonitrile (PubChem CID 139522713) has the molecular formula C34H20N4O and a molecular weight of 500.56 g/mol. Its IUPAC name is 4-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]benzonitrile.
| Compound Name | 4-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]benzonitrile |
|---|---|
| PubChem CID | 139522713 |
| Molecular Formula | C34H20N4O |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 4-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3oc4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4c3c2)cc1 |
| InChI | InChI=1S/C34H20N4O/c35-21-22-11-13-23(14-12-22)26-15-17-30-28(19-26)29-20-27(16-18-31(29)39-30)34-37-32(24-7-3-1-4-8-24)36-33(38-34)25-9-5-2-6-10-25/h1-20H |
| InChIKey | XRWBXKQNCKVLPZ-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 75.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |