C28H16N4O — CID 139522762
7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-3-carbonitrile (PubChem CID 139522762) has the molecular formula C28H16N4O and a molecular weight of 424.46 g/mol. Its IUPAC name is 7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-3-carbonitrile.
| Compound Name | 7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 139522762 |
| Molecular Formula | C28H16N4O |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-3-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)oc1cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc12 |
| InChI | InChI=1S/C28H16N4O/c29-17-18-11-13-22-23-14-12-21(16-25(23)33-24(22)15-18)28-31-26(19-7-3-1-4-8-19)30-27(32-28)20-9-5-2-6-10-20/h1-16H |
| InChIKey | AJRSYKMHCUDWAJ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 75.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |