C25H21N3O — CID 139177966
2-methoxy-8-methyl-4-(4-methylphenyl)-6,11-dihydro-5H-pyrido[2,3-a]carbazole-3-carbonitrile (PubChem CID 139177966) has the molecular formula C25H21N3O and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-methoxy-8-methyl-4-(4-methylphenyl)-6,11-dihydro-5H-pyrido[2,3-a]carbazole-3-carbonitrile.
| Compound Name | 2-methoxy-8-methyl-4-(4-methylphenyl)-6,11-dihydro-5H-pyrido[2,3-a]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 139177966 |
| Molecular Formula | C25H21N3O |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 2-methoxy-8-methyl-4-(4-methylphenyl)-6,11-dihydro-5H-pyrido[2,3-a]carbazole-3-carbonitrile |
| SMILES | COc1nc2c(c(-c3ccc(C)cc3)c1C#N)CCc1c-2[nH]c2ccc(C)cc12 |
| InChI | InChI=1S/C25H21N3O/c1-14-4-7-16(8-5-14)22-18-10-9-17-19-12-15(2)6-11-21(19)27-23(17)24(18)28-25(29-3)20(22)13-26/h4-8,11-12,27H,9-10H2,1-3H3 |
| InChIKey | QTGKMGZJCXCDDD-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|