C18H15N2+ — CID 46907599
2-benzyl-9H-pyrido[3,4-b]indol-2-ium (PubChem CID 46907599) has the molecular formula C18H15N2+ and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-benzyl-9H-pyrido[3,4-b]indol-2-ium.
| Compound Name | 2-benzyl-9H-pyrido[3,4-b]indol-2-ium |
|---|---|
| PubChem CID | 46907599 |
| Molecular Formula | C18H15N2+ |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-benzyl-9H-pyrido[3,4-b]indol-2-ium |
| SMILES | c1ccc(C[n+]2ccc3c(c2)[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C18H14N2/c1-2-6-14(7-3-1)12-20-11-10-16-15-8-4-5-9-17(15)19-18(16)13-20/h1-11,13H,12H2/p+1 |
| InChIKey | OPWBFHCBVZCDAC-UHFFFAOYSA-O |
| XLogP | 3.66 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|