About 2-[9-(9H-pyrido[3,4-b]indol-2-ium-2-yl)nonyl]-9H-pyrido[3,4-b]indol-2-ium
2-[9-(9H-pyrido[3,4-b]indol-2-ium-2-yl)nonyl]-9H-pyrido[3,4-b]indol-2-ium (PubChem CID 46222889) has the molecular formula C31H34N4+2
and a molecular weight of 462.64 g/mol. Its IUPAC name is 2-[9-(9H-pyrido[3,4-b]indol-2-ium-2-yl)nonyl]-9H-pyrido[3,4-b]indol-2-ium.
Molecular Properties
| Compound Name | 2-[9-(9H-pyrido[3,4-b]indol-2-ium-2-yl)nonyl]-9H-pyrido[3,4-b]indol-2-ium |
| PubChem CID | 46222889 |
| Molecular Formula | C31H34N4+2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | 2-[9-(9H-pyrido[3,4-b]indol-2-ium-2-yl)nonyl]-9H-pyrido[3,4-b]indol-2-ium |
| SMILES | c1ccc2c(c1)[nH]c1c[n+](CCCCCCCCC[n+]3ccc4c(c3)[nH]c3ccccc34)ccc12 |
| InChI | InChI=1S/C31H32N4/c1(2-4-10-18-34-20-16-26-24-12-6-8-14-28(24)32-30(26)22-34)3-5-11-19-35-21-17-27-25-13-7-9-15-29(25)33-31(27)23-35/h6-9,12-17,20-23H,1-5,10-11,18-19H2/p+2 |
| InChIKey | OBGGTWXFOZQOKR-UHFFFAOYSA-P |
| XLogP | 6.96 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[9-(9H-pyrido[3,4-b]indol-2-ium-2-yl)nonyl]-9H-pyrido[3,4-b]indol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[9-(9H-pyrido[3,4-b]indol-2-ium-2-yl)nonyl]-9H-pyrido[3,4-b]indol-2-ium?
The IUPAC name of 2-[9-(9H-pyrido[3,4-b]indol-2-ium-2-yl)nonyl]-9H-pyrido[3,4-b]indol-2-ium (CID 46222889) is 2-[9-(9H-pyrido[3,4-b]indol-2-ium-2-yl)nonyl]-9H-pyrido[3,4-b]indol-2-ium.
What is the SMILES notation for 2-[9-(9H-pyrido[3,4-b]indol-2-ium-2-yl)nonyl]-9H-pyrido[3,4-b]indol-2-ium?
The canonical SMILES for 2-[9-(9H-pyrido[3,4-b]indol-2-ium-2-yl)nonyl]-9H-pyrido[3,4-b]indol-2-ium is c1ccc2c(c1)[nH]c1c[n+](CCCCCCCCC[n+]3ccc4c(c3)[nH]c3ccccc34)ccc12.
What is the InChIKey of 2-[9-(9H-pyrido[3,4-b]indol-2-ium-2-yl)nonyl]-9H-pyrido[3,4-b]indol-2-ium?
The InChIKey is OBGGTWXFOZQOKR-UHFFFAOYSA-P. The full InChI is InChI=1S/C31H32N4/c1(2-4-10-18-34-20-16-26-24-12-6-8-14-28(24)32-30(26)22-34)3-5-11-19-35-21-17-27-25-13-7-9-15-29(25)33-31(27)23-35/h6-9,12-17,20-23H,1-5,10-11,18-19H2/p+2.
What are the key properties of 2-[9-(9H-pyrido[3,4-b]indol-2-ium-2-yl)nonyl]-9H-pyrido[3,4-b]indol-2-ium?
2-[9-(9H-pyrido[3,4-b]indol-2-ium-2-yl)nonyl]-9H-pyrido[3,4-b]indol-2-ium has a molecular weight of 462.64 g/mol, XLogP of 6.96, 10 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[9-(9H-pyrido[3,4-b]indol-2-ium-2-yl)nonyl]-9H-pyrido[3,4-b]indol-2-ium is sourced from PubChem (CID 46222889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).