About 2-(6-pyridin-1-ium-1-ylhexyl)-9H-pyrido[3,4-b]indol-2-ium
2-(6-pyridin-1-ium-1-ylhexyl)-9H-pyrido[3,4-b]indol-2-ium (PubChem CID 46222449) has the molecular formula C22H25N3+2
and a molecular weight of 331.46 g/mol. Its IUPAC name is 2-(6-pyridin-1-ium-1-ylhexyl)-9H-pyrido[3,4-b]indol-2-ium.
Molecular Properties
| Compound Name | 2-(6-pyridin-1-ium-1-ylhexyl)-9H-pyrido[3,4-b]indol-2-ium |
| PubChem CID | 46222449 |
| Molecular Formula | C22H25N3+2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 2-(6-pyridin-1-ium-1-ylhexyl)-9H-pyrido[3,4-b]indol-2-ium |
| SMILES | c1cc[n+](CCCCCC[n+]2ccc3c(c2)[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C22H24N3/c1(6-13-24-14-8-3-9-15-24)2-7-16-25-17-12-20-19-10-4-5-11-21(19)23-22(20)18-25/h3-5,8-12,14-15,17-18H,1-2,6-7,13,16H2/q+1/p+1 |
| InChIKey | ITGJRHQRAUMBLB-UHFFFAOYSA-O |
| XLogP | 4.16 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-pyridin-1-ium-1-ylhexyl)-9H-pyrido[3,4-b]indol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-pyridin-1-ium-1-ylhexyl)-9H-pyrido[3,4-b]indol-2-ium?
The IUPAC name of 2-(6-pyridin-1-ium-1-ylhexyl)-9H-pyrido[3,4-b]indol-2-ium (CID 46222449) is 2-(6-pyridin-1-ium-1-ylhexyl)-9H-pyrido[3,4-b]indol-2-ium.
What is the SMILES notation for 2-(6-pyridin-1-ium-1-ylhexyl)-9H-pyrido[3,4-b]indol-2-ium?
The canonical SMILES for 2-(6-pyridin-1-ium-1-ylhexyl)-9H-pyrido[3,4-b]indol-2-ium is c1cc[n+](CCCCCC[n+]2ccc3c(c2)[nH]c2ccccc23)cc1.
What is the InChIKey of 2-(6-pyridin-1-ium-1-ylhexyl)-9H-pyrido[3,4-b]indol-2-ium?
The InChIKey is ITGJRHQRAUMBLB-UHFFFAOYSA-O. The full InChI is InChI=1S/C22H24N3/c1(6-13-24-14-8-3-9-15-24)2-7-16-25-17-12-20-19-10-4-5-11-21(19)23-22(20)18-25/h3-5,8-12,14-15,17-18H,1-2,6-7,13,16H2/q+1/p+1.
What are the key properties of 2-(6-pyridin-1-ium-1-ylhexyl)-9H-pyrido[3,4-b]indol-2-ium?
2-(6-pyridin-1-ium-1-ylhexyl)-9H-pyrido[3,4-b]indol-2-ium has a molecular weight of 331.46 g/mol, XLogP of 4.16, 7 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-pyridin-1-ium-1-ylhexyl)-9H-pyrido[3,4-b]indol-2-ium is sourced from PubChem (CID 46222449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).