C19H17N2O+ — CID 91235494
(2-benzyl-9H-pyrido[3,4-b]indol-2-ium-7-yl)methanol (PubChem CID 91235494) has the molecular formula C19H17N2O+ and a molecular weight of 289.36 g/mol. Its IUPAC name is (2-benzyl-9H-pyrido[3,4-b]indol-2-ium-7-yl)methanol.
| Compound Name | (2-benzyl-9H-pyrido[3,4-b]indol-2-ium-7-yl)methanol |
|---|---|
| PubChem CID | 91235494 |
| Molecular Formula | C19H17N2O+ |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (2-benzyl-9H-pyrido[3,4-b]indol-2-ium-7-yl)methanol |
| SMILES | OCc1ccc2c(c1)[nH]c1c[n+](Cc3ccccc3)ccc12 |
| InChI | InChI=1S/C19H16N2O/c22-13-15-6-7-16-17-8-9-21(11-14-4-2-1-3-5-14)12-19(17)20-18(16)10-15/h1-10,12,22H,11,13H2/p+1 |
| InChIKey | AQZBTAFUWOWYOZ-UHFFFAOYSA-O |
| XLogP | 3.15 |
| TPSA | 39.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|