C14H12N2O — CID 147230714
7-ethenoxy-1-methyl-9H-pyrido[3,4-b]indole (PubChem CID 147230714) has the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. Its IUPAC name is 7-ethenoxy-1-methyl-9H-pyrido[3,4-b]indole.
| Compound Name | 7-ethenoxy-1-methyl-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 147230714 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 7-ethenoxy-1-methyl-9H-pyrido[3,4-b]indole |
| SMILES | C=COc1ccc2c(c1)[nH]c1c(C)nccc12 |
| InChI | InChI=1S/C14H12N2O/c1-3-17-10-4-5-11-12-6-7-15-9(2)14(12)16-13(11)8-10/h3-8,16H,1H2,2H3 |
| InChIKey | CIVZKXJRLMYYTD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|