C15H12N2O3 — CID 163192645
3-(7-methoxy-9H-pyrido[3,4-b]indol-1-yl)prop-2-enoic acid (PubChem CID 163192645) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 3-(7-methoxy-9H-pyrido[3,4-b]indol-1-yl)prop-2-enoic acid.
| Compound Name | 3-(7-methoxy-9H-pyrido[3,4-b]indol-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 163192645 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 3-(7-methoxy-9H-pyrido[3,4-b]indol-1-yl)prop-2-enoic acid |
| SMILES | COc1ccc2c(c1)[nH]c1c(C=CC(=O)O)nccc12 |
| InChI | InChI=1S/C15H12N2O3/c1-20-9-2-3-10-11-6-7-16-12(4-5-14(18)19)15(11)17-13(10)8-9/h2-8,17H,1H3,(H,18,19) |
| InChIKey | FOUMUZPVQDJJBA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|